ChemNet > CAS > 4926-47-0 3-bromoimidazo[1,2-a]pyridine
4926-47-0 3-bromoimidazo[1,2-a]pyridine
| Naam product |
3-bromoimidazo[1,2-a]pyridine |
| Engelse naam |
3-bromoimidazo[1,2-a]pyridine; 3-Bromopyrimidazole; Imidazo[1,2-a]pyridine, 3-bromo- |
| MF |
C7H5BrN2 |
| Molecuulgewicht |
197.032 |
| InChI |
InChI=1/C7H5BrN2/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H |
| CAS-nummer |
4926-47-0 |
| Moleculaire Structuur |
![4926-47-0 3-bromoimidazo[1,2-a]pyridine](https://images-a.chemnet.com/suppliers/chembase/116/116494_1.gif)
|
| Dichtheid |
1.69g/cm3 |
| Smeltpunt |
82℃ |
| Brekingsindex |
1.688 |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
